C16H18N2O3 — CID 9232780
N-[(Z)-[(1R,5S)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-3,4-dimethoxybenzamide (PubChem CID 9232780) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is N-[(Z)-[(1R,5S)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-3,4-dimethoxybenzamide.
| Compound Name | N-[(Z)-[(1R,5S)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 9232780 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | N-[(Z)-[(1R,5S)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)N/N=C2/C[C@@H]3C=CC[C@H]23)cc1OC |
| InChI | InChI=1S/C16H18N2O3/c1-20-14-7-6-11(9-15(14)21-2)16(19)18-17-13-8-10-4-3-5-12(10)13/h3-4,6-7,9-10,12H,5,8H2,1-2H3,(H,18,19)/b17-13-/t10-,12-/m0/s1 |
| InChIKey | CKIBDWQTLIMSTQ-MEVQHSSJSA-N |
| XLogP | 2.39 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|