C14H16N2O2 — CID 129431579
N-[[(1S,4S)-2-bicyclo[2.2.1]heptanylidene]amino]-4-hydroxybenzamide (PubChem CID 129431579) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is N-[[(1S,4S)-2-bicyclo[2.2.1]heptanylidene]amino]-4-hydroxybenzamide.
| Compound Name | N-[[(1S,4S)-2-bicyclo[2.2.1]heptanylidene]amino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 129431579 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | N-[[(1S,4S)-2-bicyclo[2.2.1]heptanylidene]amino]-4-hydroxybenzamide |
| SMILES | O=C(NN=C1C[C@H]2CC[C@H]1C2)c1ccc(O)cc1 |
| InChI | InChI=1S/C14H16N2O2/c17-12-5-3-10(4-6-12)14(18)16-15-13-8-9-1-2-11(13)7-9/h3-6,9,11,17H,1-2,7-8H2,(H,16,18)/t9-,11-/m0/s1 |
| InChIKey | GTOJNROBWPRSFC-ONGXEEELSA-N |
| XLogP | 2.30 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|