C11H16N2O — CID 4090822
N-(2-bicyclo[2.2.1]heptanylideneamino)cyclopropanecarboxamide (PubChem CID 4090822) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]heptanylideneamino)cyclopropanecarboxamide.
| Compound Name | N-(2-bicyclo[2.2.1]heptanylideneamino)cyclopropanecarboxamide |
|---|---|
| PubChem CID | 4090822 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | N-(2-bicyclo[2.2.1]heptanylideneamino)cyclopropanecarboxamide |
| SMILES | O=C(NN=C1CC2CCC1C2)C1CC1 |
| InChI | InChI=1S/C11H16N2O/c14-11(8-3-4-8)13-12-10-6-7-1-2-9(10)5-7/h7-9H,1-6H2,(H,13,14) |
| InChIKey | NHLNEIJLTIXMDK-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|