C16H21ClN2O — CID 5115371
3-chloro-N-[(4-propylcyclohexylidene)amino]benzamide (PubChem CID 5115371) has the molecular formula C16H21ClN2O and a molecular weight of 292.81 g/mol. Its IUPAC name is 3-chloro-N-[(4-propylcyclohexylidene)amino]benzamide.
| Compound Name | 3-chloro-N-[(4-propylcyclohexylidene)amino]benzamide |
|---|---|
| PubChem CID | 5115371 |
| Molecular Formula | C16H21ClN2O |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 3-chloro-N-[(4-propylcyclohexylidene)amino]benzamide |
| SMILES | CCCC1CCC(=NNC(=O)c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C16H21ClN2O/c1-2-4-12-7-9-15(10-8-12)18-19-16(20)13-5-3-6-14(17)11-13/h3,5-6,11-12H,2,4,7-10H2,1H3,(H,19,20)/b18-15- |
| InChIKey | SIYAZXDGYQQGGU-SDXDJHTJSA-N |
| XLogP | 4.42 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|