C18H25BrN2O — CID 4556862
3-bromo-N-[[4-(2-methylbutan-2-yl)cyclohexylidene]amino]benzamide (PubChem CID 4556862) has the molecular formula C18H25BrN2O and a molecular weight of 365.32 g/mol. Its IUPAC name is 3-bromo-N-[[4-(2-methylbutan-2-yl)cyclohexylidene]amino]benzamide.
| Compound Name | 3-bromo-N-[[4-(2-methylbutan-2-yl)cyclohexylidene]amino]benzamide |
|---|---|
| PubChem CID | 4556862 |
| Molecular Formula | C18H25BrN2O |
| Molecular Weight | 365.32 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 3-bromo-N-[[4-(2-methylbutan-2-yl)cyclohexylidene]amino]benzamide |
| SMILES | CCC(C)(C)C1CCC(=NNC(=O)c2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C18H25BrN2O/c1-4-18(2,3)14-8-10-16(11-9-14)20-21-17(22)13-6-5-7-15(19)12-13/h5-7,12,14H,4,8-11H2,1-3H3,(H,21,22)/b20-16- |
| InChIKey | UUFVSBCGPQDDCG-SILNSSARSA-N |
| XLogP | 5.16 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.32 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|