C22H30N4O2 — CID 9465123
N-[(Z)-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]amino]-4-oxo-3-propylphthalazine-1-carboxamide (PubChem CID 9465123) has the molecular formula C22H30N4O2 and a molecular weight of 382.51 g/mol. Its IUPAC name is N-[(Z)-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]amino]-4-oxo-3-propylphthalazine-1-carboxamide.
| Compound Name | N-[(Z)-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]amino]-4-oxo-3-propylphthalazine-1-carboxamide |
|---|---|
| PubChem CID | 9465123 |
| Molecular Formula | C22H30N4O2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | N-[(Z)-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]amino]-4-oxo-3-propylphthalazine-1-carboxamide |
| SMILES | CCCn1nc(C(=O)N/N=C2/C[C@H](C)CC[C@H]2C(C)C)c2ccccc2c1=O |
| InChI | InChI=1S/C22H30N4O2/c1-5-12-26-22(28)18-9-7-6-8-17(18)20(25-26)21(27)24-23-19-13-15(4)10-11-16(19)14(2)3/h6-9,14-16H,5,10-13H2,1-4H3,(H,24,27)/b23-19-/t15-,16+/m1/s1 |
| InChIKey | IYSPMCMHGHRIKH-UMSQGIPESA-N |
| XLogP | 3.98 |
| TPSA | 76.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|