C19H24N2O4S — CID 72879903
[3-[[(3aS,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]sulfonyl]phenyl]-morpholin-4-ylmethanone (PubChem CID 72879903) has the molecular formula C19H24N2O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is [3-[[(3aS,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]sulfonyl]phenyl]-morpholin-4-ylmethanone.
| Compound Name | [3-[[(3aS,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]sulfonyl]phenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 72879903 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | [3-[[(3aS,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]sulfonyl]phenyl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1cccc(S(=O)(=O)N2C[C@H]3CC=CC[C@H]3C2)c1)N1CCOCC1 |
| InChI | InChI=1S/C19H24N2O4S/c22-19(20-8-10-25-11-9-20)15-6-3-7-18(12-15)26(23,24)21-13-16-4-1-2-5-17(16)14-21/h1-3,6-7,12,16-17H,4-5,8-11,13-14H2/t16-,17+ |
| InChIKey | RDPGFOLLLZMHOS-CALCHBBNSA-N |
| XLogP | 1.75 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|