C16H22N2O4S2 — CID 72916871
[3-(1,4-oxazepan-4-ylsulfonyl)phenyl]-thiomorpholin-4-ylmethanone (PubChem CID 72916871) has the molecular formula C16H22N2O4S2 and a molecular weight of 370.50 g/mol. Its IUPAC name is [3-(1,4-oxazepan-4-ylsulfonyl)phenyl]-thiomorpholin-4-ylmethanone.
| Compound Name | [3-(1,4-oxazepan-4-ylsulfonyl)phenyl]-thiomorpholin-4-ylmethanone |
|---|---|
| PubChem CID | 72916871 |
| Molecular Formula | C16H22N2O4S2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | [3-(1,4-oxazepan-4-ylsulfonyl)phenyl]-thiomorpholin-4-ylmethanone |
| SMILES | O=C(c1cccc(S(=O)(=O)N2CCCOCC2)c1)N1CCSCC1 |
| InChI | InChI=1S/C16H22N2O4S2/c19-16(17-7-11-23-12-8-17)14-3-1-4-15(13-14)24(20,21)18-5-2-9-22-10-6-18/h1,3-4,13H,2,5-12H2 |
| InChIKey | CYWDYKBJFBWJBC-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |