C20H28N2O4S — CID 9295928
[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(3-morpholin-4-ylsulfonylphenyl)methanone (PubChem CID 9295928) has the molecular formula C20H28N2O4S and a molecular weight of 392.52 g/mol. Its IUPAC name is [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(3-morpholin-4-ylsulfonylphenyl)methanone.
| Compound Name | [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(3-morpholin-4-ylsulfonylphenyl)methanone |
|---|---|
| PubChem CID | 9295928 |
| Molecular Formula | C20H28N2O4S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(3-morpholin-4-ylsulfonylphenyl)methanone |
| SMILES | O=C(c1cccc(S(=O)(=O)N2CCOCC2)c1)N1CC[C@@H]2CCCC[C@H]2C1 |
| InChI | InChI=1S/C20H28N2O4S/c23-20(21-9-8-16-4-1-2-5-18(16)15-21)17-6-3-7-19(14-17)27(24,25)22-10-12-26-13-11-22/h3,6-7,14,16,18H,1-2,4-5,8-13,15H2/t16-,18-/m0/s1 |
| InChIKey | PTNWGXKJPXQZBO-WMZOPIPTSA-N |
| XLogP | 2.36 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |