C21H30N2O5S — CID 9489943
[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)methanone (PubChem CID 9489943) has the molecular formula C21H30N2O5S and a molecular weight of 422.55 g/mol. Its IUPAC name is [(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)methanone.
| Compound Name | [(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)methanone |
|---|---|
| PubChem CID | 9489943 |
| Molecular Formula | C21H30N2O5S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | [(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)methanone |
| SMILES | COc1ccc(S(=O)(=O)N2CCOCC2)cc1C(=O)N1CC[C@H]2CCCC[C@@H]2C1 |
| InChI | InChI=1S/C21H30N2O5S/c1-27-20-7-6-18(29(25,26)23-10-12-28-13-11-23)14-19(20)21(24)22-9-8-16-4-2-3-5-17(16)15-22/h6-7,14,16-17H,2-5,8-13,15H2,1H3/t16-,17-/m1/s1 |
| InChIKey | DFZDUAWXKRPBCT-IAGOWNOFSA-N |
| XLogP | 2.37 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |