C25H30N2O4S — CID 41022439
[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[5-(2,3-dihydroindol-1-ylsulfonyl)-2-methoxyphenyl]methanone (PubChem CID 41022439) has the molecular formula C25H30N2O4S and a molecular weight of 454.59 g/mol. Its IUPAC name is [(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[5-(2,3-dihydroindol-1-ylsulfonyl)-2-methoxyphenyl]methanone.
| Compound Name | [(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[5-(2,3-dihydroindol-1-ylsulfonyl)-2-methoxyphenyl]methanone |
|---|---|
| PubChem CID | 41022439 |
| Molecular Formula | C25H30N2O4S |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | [(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[5-(2,3-dihydroindol-1-ylsulfonyl)-2-methoxyphenyl]methanone |
| SMILES | COc1ccc(S(=O)(=O)N2CCc3ccccc32)cc1C(=O)N1CC[C@H]2CCCC[C@H]2C1 |
| InChI | InChI=1S/C25H30N2O4S/c1-31-24-11-10-21(32(29,30)27-15-13-19-7-4-5-9-23(19)27)16-22(24)25(28)26-14-12-18-6-2-3-8-20(18)17-26/h4-5,7,9-11,16,18,20H,2-3,6,8,12-15,17H2,1H3/t18-,20+/m1/s1 |
| InChIKey | JCXVGXJKAOUUHC-QUCCMNQESA-N |
| XLogP | 4.10 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |