C17H24N2O4S2 — CID 97192984
[3-[(3R)-3-hydroxy-3-methylpiperidin-1-yl]sulfonylphenyl]-thiomorpholin-4-ylmethanone (PubChem CID 97192984) has the molecular formula C17H24N2O4S2 and a molecular weight of 384.52 g/mol. Its IUPAC name is [3-[(3R)-3-hydroxy-3-methylpiperidin-1-yl]sulfonylphenyl]-thiomorpholin-4-ylmethanone.
| Compound Name | [3-[(3R)-3-hydroxy-3-methylpiperidin-1-yl]sulfonylphenyl]-thiomorpholin-4-ylmethanone |
|---|---|
| PubChem CID | 97192984 |
| Molecular Formula | C17H24N2O4S2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | [3-[(3R)-3-hydroxy-3-methylpiperidin-1-yl]sulfonylphenyl]-thiomorpholin-4-ylmethanone |
| SMILES | C[C@@]1(O)CCCN(S(=O)(=O)c2cccc(C(=O)N3CCSCC3)c2)C1 |
| InChI | InChI=1S/C17H24N2O4S2/c1-17(21)6-3-7-19(13-17)25(22,23)15-5-2-4-14(12-15)16(20)18-8-10-24-11-9-18/h2,4-5,12,21H,3,6-11,13H2,1H3/t17-/m1/s1 |
| InChIKey | OJUOCADXCZJOSM-QGZVFWFLSA-N |
| XLogP | 1.41 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |