C16H23N3O3S2 — CID 72885028
[3-[3-(aminomethyl)pyrrolidin-1-yl]sulfonylphenyl]-thiomorpholin-4-ylmethanone (PubChem CID 72885028) has the molecular formula C16H23N3O3S2 and a molecular weight of 369.51 g/mol. Its IUPAC name is [3-[3-(aminomethyl)pyrrolidin-1-yl]sulfonylphenyl]-thiomorpholin-4-ylmethanone.
| Compound Name | [3-[3-(aminomethyl)pyrrolidin-1-yl]sulfonylphenyl]-thiomorpholin-4-ylmethanone |
|---|---|
| PubChem CID | 72885028 |
| Molecular Formula | C16H23N3O3S2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | [3-[3-(aminomethyl)pyrrolidin-1-yl]sulfonylphenyl]-thiomorpholin-4-ylmethanone |
| SMILES | NCC1CCN(S(=O)(=O)c2cccc(C(=O)N3CCSCC3)c2)C1 |
| InChI | InChI=1S/C16H23N3O3S2/c17-11-13-4-5-19(12-13)24(21,22)15-3-1-2-14(10-15)16(20)18-6-8-23-9-7-18/h1-3,10,13H,4-9,11-12,17H2 |
| InChIKey | DXAQPUBMOAPCEQ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |