C15H21N3O3S2 — CID 70766156
[4-(3-aminopyrrolidin-1-yl)sulfonylphenyl]-thiomorpholin-4-ylmethanone (PubChem CID 70766156) has the molecular formula C15H21N3O3S2 and a molecular weight of 355.49 g/mol. Its IUPAC name is [4-(3-aminopyrrolidin-1-yl)sulfonylphenyl]-thiomorpholin-4-ylmethanone.
| Compound Name | [4-(3-aminopyrrolidin-1-yl)sulfonylphenyl]-thiomorpholin-4-ylmethanone |
|---|---|
| PubChem CID | 70766156 |
| Molecular Formula | C15H21N3O3S2 |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | [4-(3-aminopyrrolidin-1-yl)sulfonylphenyl]-thiomorpholin-4-ylmethanone |
| SMILES | NC1CCN(S(=O)(=O)c2ccc(C(=O)N3CCSCC3)cc2)C1 |
| InChI | InChI=1S/C15H21N3O3S2/c16-13-5-6-18(11-13)23(20,21)14-3-1-12(2-4-14)15(19)17-7-9-22-10-8-17/h1-4,13H,5-11,16H2 |
| InChIKey | IIMAIANJCPGFTG-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |