C15H20N2O4S2 — CID 97129320
[(3S)-3-hydroxypyrrolidin-1-yl]-(4-thiomorpholin-4-ylsulfonylphenyl)methanone (PubChem CID 97129320) has the molecular formula C15H20N2O4S2 and a molecular weight of 356.47 g/mol. Its IUPAC name is [(3S)-3-hydroxypyrrolidin-1-yl]-(4-thiomorpholin-4-ylsulfonylphenyl)methanone.
| Compound Name | [(3S)-3-hydroxypyrrolidin-1-yl]-(4-thiomorpholin-4-ylsulfonylphenyl)methanone |
|---|---|
| PubChem CID | 97129320 |
| Molecular Formula | C15H20N2O4S2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | [(3S)-3-hydroxypyrrolidin-1-yl]-(4-thiomorpholin-4-ylsulfonylphenyl)methanone |
| SMILES | O=C(c1ccc(S(=O)(=O)N2CCSCC2)cc1)N1CC[C@H](O)C1 |
| InChI | InChI=1S/C15H20N2O4S2/c18-13-5-6-16(11-13)15(19)12-1-3-14(4-2-12)23(20,21)17-7-9-22-10-8-17/h1-4,13,18H,5-11H2/t13-/m0/s1 |
| InChIKey | DVSHHUUVLYPLPE-ZDUSSCGKSA-N |
| XLogP | 0.63 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |