C19H23N3O6S3 — CID 2542470
(3-morpholin-4-ylsulfonylphenyl)-(4-thiophen-2-ylsulfonylpiperazin-1-yl)methanone (PubChem CID 2542470) has the molecular formula C19H23N3O6S3 and a molecular weight of 485.61 g/mol. Its IUPAC name is (3-morpholin-4-ylsulfonylphenyl)-(4-thiophen-2-ylsulfonylpiperazin-1-yl)methanone.
| Compound Name | (3-morpholin-4-ylsulfonylphenyl)-(4-thiophen-2-ylsulfonylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 2542470 |
| Molecular Formula | C19H23N3O6S3 |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.07 |
| IUPAC Name | (3-morpholin-4-ylsulfonylphenyl)-(4-thiophen-2-ylsulfonylpiperazin-1-yl)methanone |
| SMILES | O=C(c1cccc(S(=O)(=O)N2CCOCC2)c1)N1CCN(S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C19H23N3O6S3/c23-19(20-6-8-21(9-7-20)31(26,27)18-5-2-14-29-18)16-3-1-4-17(15-16)30(24,25)22-10-12-28-13-11-22/h1-5,14-15H,6-13H2 |
| InChIKey | MXKGNWBBBSAFPM-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 104.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |