C15H15BrN2O3S2 — CID 38068388
(3-bromophenyl)-(4-thiophen-2-ylsulfonylpiperazin-1-yl)methanone (PubChem CID 38068388) has the molecular formula C15H15BrN2O3S2 and a molecular weight of 415.33 g/mol. Its IUPAC name is (3-bromophenyl)-(4-thiophen-2-ylsulfonylpiperazin-1-yl)methanone.
| Compound Name | (3-bromophenyl)-(4-thiophen-2-ylsulfonylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 38068388 |
| Molecular Formula | C15H15BrN2O3S2 |
| Molecular Weight | 415.33 g/mol |
| Exact Mass | 413.97 |
| IUPAC Name | (3-bromophenyl)-(4-thiophen-2-ylsulfonylpiperazin-1-yl)methanone |
| SMILES | O=C(c1cccc(Br)c1)N1CCN(S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C15H15BrN2O3S2/c16-13-4-1-3-12(11-13)15(19)17-6-8-18(9-7-17)23(20,21)14-5-2-10-22-14/h1-5,10-11H,6-9H2 |
| InChIKey | OGGMKRFYOGBZQX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |