C19H22BrN3O3S — CID 27829290
[4-(3-bromophenyl)sulfonylpiperazin-1-yl]-[3-(dimethylamino)phenyl]methanone (PubChem CID 27829290) has the molecular formula C19H22BrN3O3S and a molecular weight of 452.37 g/mol. Its IUPAC name is [4-(3-bromophenyl)sulfonylpiperazin-1-yl]-[3-(dimethylamino)phenyl]methanone.
| Compound Name | [4-(3-bromophenyl)sulfonylpiperazin-1-yl]-[3-(dimethylamino)phenyl]methanone |
|---|---|
| PubChem CID | 27829290 |
| Molecular Formula | C19H22BrN3O3S |
| Molecular Weight | 452.37 g/mol |
| Exact Mass | 451.06 |
| IUPAC Name | [4-(3-bromophenyl)sulfonylpiperazin-1-yl]-[3-(dimethylamino)phenyl]methanone |
| SMILES | CN(C)c1cccc(C(=O)N2CCN(S(=O)(=O)c3cccc(Br)c3)CC2)c1 |
| InChI | InChI=1S/C19H22BrN3O3S/c1-21(2)17-7-3-5-15(13-17)19(24)22-9-11-23(12-10-22)27(25,26)18-8-4-6-16(20)14-18/h3-8,13-14H,9-12H2,1-2H3 |
| InChIKey | CIOLZMAICZOPDA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |