C16H18N4O3S2 — CID 18382172
4-(4-thiophen-2-ylsulfonylpiperazine-1-carbonyl)benzenecarboximidamide (PubChem CID 18382172) has the molecular formula C16H18N4O3S2 and a molecular weight of 378.48 g/mol. Its IUPAC name is 4-(4-thiophen-2-ylsulfonylpiperazine-1-carbonyl)benzenecarboximidamide.
| Compound Name | 4-(4-thiophen-2-ylsulfonylpiperazine-1-carbonyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 18382172 |
| Molecular Formula | C16H18N4O3S2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 4-(4-thiophen-2-ylsulfonylpiperazine-1-carbonyl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)N2CCN(S(=O)(=O)c3cccs3)CC2)cc1 |
| InChI | InChI=1S/C16H18N4O3S2/c17-15(18)12-3-5-13(6-4-12)16(21)19-7-9-20(10-8-19)25(22,23)14-2-1-11-24-14/h1-6,11H,7-10H2,(H3,17,18) |
| InChIKey | BTJBQQCWHLPMFY-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 107.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|