C17H20ClN3O3 — CID 110853989
ethyl 4-(7-chloro-1-methylindole-2-carbonyl)piperazine-1-carboxylate (PubChem CID 110853989) has the molecular formula C17H20ClN3O3 and a molecular weight of 349.82 g/mol. Its IUPAC name is ethyl 4-(7-chloro-1-methylindole-2-carbonyl)piperazine-1-carboxylate.
| Compound Name | ethyl 4-(7-chloro-1-methylindole-2-carbonyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 110853989 |
| Molecular Formula | C17H20ClN3O3 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | ethyl 4-(7-chloro-1-methylindole-2-carbonyl)piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)c2cc3cccc(Cl)c3n2C)CC1 |
| InChI | InChI=1S/C17H20ClN3O3/c1-3-24-17(23)21-9-7-20(8-10-21)16(22)14-11-12-5-4-6-13(18)15(12)19(14)2/h4-6,11H,3,7-10H2,1-2H3 |
| InChIKey | UZRAQMNQPYFGGX-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |