C16H17ClN2O4 — CID 56902551
2-[4-(7-chloro-1-methylindole-2-carbonyl)morpholin-3-yl]acetic acid (PubChem CID 56902551) has the molecular formula C16H17ClN2O4 and a molecular weight of 336.78 g/mol. Its IUPAC name is 2-[4-(7-chloro-1-methylindole-2-carbonyl)morpholin-3-yl]acetic acid.
| Compound Name | 2-[4-(7-chloro-1-methylindole-2-carbonyl)morpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 56902551 |
| Molecular Formula | C16H17ClN2O4 |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 2-[4-(7-chloro-1-methylindole-2-carbonyl)morpholin-3-yl]acetic acid |
| SMILES | Cn1c(C(=O)N2CCOCC2CC(=O)O)cc2cccc(Cl)c21 |
| InChI | InChI=1S/C16H17ClN2O4/c1-18-13(7-10-3-2-4-12(17)15(10)18)16(22)19-5-6-23-9-11(19)8-14(20)21/h2-4,7,11H,5-6,8-9H2,1H3,(H,20,21) |
| InChIKey | HUUHWPYCYZLRNX-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |