About methyl 5-(3,4-dimethoxypyrrolidin-1-yl)pyrazine-2-carboxylate
methyl 5-(3,4-dimethoxypyrrolidin-1-yl)pyrazine-2-carboxylate (PubChem CID 114059884) has the molecular formula C12H17N3O4
and a molecular weight of 267.28 g/mol. Its IUPAC name is methyl 5-(3,4-dimethoxypyrrolidin-1-yl)pyrazine-2-carboxylate.
Analyze methyl 5-(3,4-dimethoxypyrrolidin-1-yl)pyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-(3,4-dimethoxypyrrolidin-1-yl)pyrazine-2-carboxylate?
The IUPAC name of methyl 5-(3,4-dimethoxypyrrolidin-1-yl)pyrazine-2-carboxylate (CID 114059884) is methyl 5-(3,4-dimethoxypyrrolidin-1-yl)pyrazine-2-carboxylate.
What is the SMILES notation for methyl 5-(3,4-dimethoxypyrrolidin-1-yl)pyrazine-2-carboxylate?
The canonical SMILES for methyl 5-(3,4-dimethoxypyrrolidin-1-yl)pyrazine-2-carboxylate is COC(=O)c1cnc(N2CC(OC)C(OC)C2)cn1.
What is the InChIKey of methyl 5-(3,4-dimethoxypyrrolidin-1-yl)pyrazine-2-carboxylate?
The InChIKey is KTMXVBYRZPEZPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O4/c1-17-9-6-15(7-10(9)18-2)11-5-13-8(4-14-11)12(16)19-3/h4-5,9-10H,6-7H2,1-3H3.
What are the key properties of methyl 5-(3,4-dimethoxypyrrolidin-1-yl)pyrazine-2-carboxylate?
methyl 5-(3,4-dimethoxypyrrolidin-1-yl)pyrazine-2-carboxylate has a molecular weight of 267.28 g/mol, XLogP of 0.11, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(3,4-dimethoxypyrrolidin-1-yl)pyrazine-2-carboxylate is sourced from PubChem (CID 114059884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).