C11H16ClN3O2 — CID 107373590
2-(chloromethyl)-5-(3,4-dimethoxypyrrolidin-1-yl)pyrazine (PubChem CID 107373590) has the molecular formula C11H16ClN3O2 and a molecular weight of 257.72 g/mol. Its IUPAC name is 2-(chloromethyl)-5-(3,4-dimethoxypyrrolidin-1-yl)pyrazine.
| Compound Name | 2-(chloromethyl)-5-(3,4-dimethoxypyrrolidin-1-yl)pyrazine |
|---|---|
| PubChem CID | 107373590 |
| Molecular Formula | C11H16ClN3O2 |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 2-(chloromethyl)-5-(3,4-dimethoxypyrrolidin-1-yl)pyrazine |
| SMILES | COC1CN(c2cnc(CCl)cn2)CC1OC |
| InChI | InChI=1S/C11H16ClN3O2/c1-16-9-6-15(7-10(9)17-2)11-5-13-8(3-12)4-14-11/h4-5,9-10H,3,6-7H2,1-2H3 |
| InChIKey | VARKZXFLTQKYER-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|