C12H16ClN3O2S — CID 103535533
5-(chloromethyl)-6-(3,4-dimethoxypyrrolidin-1-yl)imidazo[2,1-b][1,3]thiazole (PubChem CID 103535533) has the molecular formula C12H16ClN3O2S and a molecular weight of 301.80 g/mol. Its IUPAC name is 5-(chloromethyl)-6-(3,4-dimethoxypyrrolidin-1-yl)imidazo[2,1-b][1,3]thiazole.
| Compound Name | 5-(chloromethyl)-6-(3,4-dimethoxypyrrolidin-1-yl)imidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 103535533 |
| Molecular Formula | C12H16ClN3O2S |
| Molecular Weight | 301.80 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 5-(chloromethyl)-6-(3,4-dimethoxypyrrolidin-1-yl)imidazo[2,1-b][1,3]thiazole |
| SMILES | COC1CN(c2nc3sccn3c2CCl)CC1OC |
| InChI | InChI=1S/C12H16ClN3O2S/c1-17-9-6-15(7-10(9)18-2)11-8(5-13)16-3-4-19-12(16)14-11/h3-4,9-10H,5-7H2,1-2H3 |
| InChIKey | FLBYOOODOQNUQO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 39.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.80 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|