C10H12ClN3OS2 — CID 54977364
4-[5-(chloromethyl)imidazo[2,1-b][1,3]thiazol-6-yl]-1,4-thiazinane 1-oxide (PubChem CID 54977364) has the molecular formula C10H12ClN3OS2 and a molecular weight of 289.81 g/mol. Its IUPAC name is 4-[5-(chloromethyl)imidazo[2,1-b][1,3]thiazol-6-yl]-1,4-thiazinane 1-oxide.
| Compound Name | 4-[5-(chloromethyl)imidazo[2,1-b][1,3]thiazol-6-yl]-1,4-thiazinane 1-oxide |
|---|---|
| PubChem CID | 54977364 |
| Molecular Formula | C10H12ClN3OS2 |
| Molecular Weight | 289.81 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | 4-[5-(chloromethyl)imidazo[2,1-b][1,3]thiazol-6-yl]-1,4-thiazinane 1-oxide |
| SMILES | O=S1CCN(c2nc3sccn3c2CCl)CC1 |
| InChI | InChI=1S/C10H12ClN3OS2/c11-7-8-9(12-10-14(8)1-4-16-10)13-2-5-17(15)6-3-13/h1,4H,2-3,5-7H2 |
| InChIKey | NSRWIXDWMVGKHY-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.81 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|