C10H12BrN3O2S2 — CID 107080490
4-[5-(bromomethyl)imidazo[2,1-b][1,3]thiazol-6-yl]-1,4-thiazinane 1,1-dioxide (PubChem CID 107080490) has the molecular formula C10H12BrN3O2S2 and a molecular weight of 350.26 g/mol. Its IUPAC name is 4-[5-(bromomethyl)imidazo[2,1-b][1,3]thiazol-6-yl]-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-[5-(bromomethyl)imidazo[2,1-b][1,3]thiazol-6-yl]-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 107080490 |
| Molecular Formula | C10H12BrN3O2S2 |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 348.96 |
| IUPAC Name | 4-[5-(bromomethyl)imidazo[2,1-b][1,3]thiazol-6-yl]-1,4-thiazinane 1,1-dioxide |
| SMILES | O=S1(=O)CCN(c2nc3sccn3c2CBr)CC1 |
| InChI | InChI=1S/C10H12BrN3O2S2/c11-7-8-9(12-10-14(8)1-4-17-10)13-2-5-18(15,16)6-3-13/h1,4H,2-3,5-7H2 |
| InChIKey | TZEQPVDCTROBNC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 54.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|