C13H19BrN4S — CID 107084284
1-[5-(bromomethyl)imidazo[2,1-b][1,3]thiazol-6-yl]-N,N-dimethylpiperidin-3-amine (PubChem CID 107084284) has the molecular formula C13H19BrN4S and a molecular weight of 343.29 g/mol. Its IUPAC name is 1-[5-(bromomethyl)imidazo[2,1-b][1,3]thiazol-6-yl]-N,N-dimethylpiperidin-3-amine.
| Compound Name | 1-[5-(bromomethyl)imidazo[2,1-b][1,3]thiazol-6-yl]-N,N-dimethylpiperidin-3-amine |
|---|---|
| PubChem CID | 107084284 |
| Molecular Formula | C13H19BrN4S |
| Molecular Weight | 343.29 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 1-[5-(bromomethyl)imidazo[2,1-b][1,3]thiazol-6-yl]-N,N-dimethylpiperidin-3-amine |
| SMILES | CN(C)C1CCCN(c2nc3sccn3c2CBr)C1 |
| InChI | InChI=1S/C13H19BrN4S/c1-16(2)10-4-3-5-17(9-10)12-11(8-14)18-6-7-19-13(18)15-12/h6-7,10H,3-5,8-9H2,1-2H3 |
| InChIKey | JQFSAEJTYLJSOF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 23.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|