C15H23N5S — CID 63150946
1-[6-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl)imidazo[2,1-b][1,3]thiazol-5-yl]-N-methylmethanamine (PubChem CID 63150946) has the molecular formula C15H23N5S and a molecular weight of 305.45 g/mol. Its IUPAC name is 1-[6-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl)imidazo[2,1-b][1,3]thiazol-5-yl]-N-methylmethanamine.
| Compound Name | 1-[6-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl)imidazo[2,1-b][1,3]thiazol-5-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 63150946 |
| Molecular Formula | C15H23N5S |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 1-[6-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl)imidazo[2,1-b][1,3]thiazol-5-yl]-N-methylmethanamine |
| SMILES | CNCc1c(N2CCCN3CCCC3C2)nc2sccn12 |
| InChI | InChI=1S/C15H23N5S/c1-16-10-13-14(17-15-20(13)8-9-21-15)19-7-3-6-18-5-2-4-12(18)11-19/h8-9,12,16H,2-7,10-11H2,1H3 |
| InChIKey | HASSSAPUYBEVSY-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 35.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |