C15H24N4OS — CID 63059967
2-methoxy-N-[[6-(3-methylpiperidin-1-yl)imidazo[2,1-b][1,3]thiazol-5-yl]methyl]ethanamine (PubChem CID 63059967) has the molecular formula C15H24N4OS and a molecular weight of 308.45 g/mol. Its IUPAC name is 2-methoxy-N-[[6-(3-methylpiperidin-1-yl)imidazo[2,1-b][1,3]thiazol-5-yl]methyl]ethanamine.
| Compound Name | 2-methoxy-N-[[6-(3-methylpiperidin-1-yl)imidazo[2,1-b][1,3]thiazol-5-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 63059967 |
| Molecular Formula | C15H24N4OS |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 2-methoxy-N-[[6-(3-methylpiperidin-1-yl)imidazo[2,1-b][1,3]thiazol-5-yl]methyl]ethanamine |
| SMILES | COCCNCc1c(N2CCCC(C)C2)nc2sccn12 |
| InChI | InChI=1S/C15H24N4OS/c1-12-4-3-6-18(11-12)14-13(10-16-5-8-20-2)19-7-9-21-15(19)17-14/h7,9,12,16H,3-6,8,10-11H2,1-2H3 |
| InChIKey | CVZYUSZFLFHHRS-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 41.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|