C13H20N4O3S — CID 106670393
1-[5-[(2-methoxyethylamino)methyl]imidazo[2,1-b][1,3]thiazol-6-yl]pyrrolidine-3,4-diol (PubChem CID 106670393) has the molecular formula C13H20N4O3S and a molecular weight of 312.40 g/mol. Its IUPAC name is 1-[5-[(2-methoxyethylamino)methyl]imidazo[2,1-b][1,3]thiazol-6-yl]pyrrolidine-3,4-diol.
| Compound Name | 1-[5-[(2-methoxyethylamino)methyl]imidazo[2,1-b][1,3]thiazol-6-yl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106670393 |
| Molecular Formula | C13H20N4O3S |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 1-[5-[(2-methoxyethylamino)methyl]imidazo[2,1-b][1,3]thiazol-6-yl]pyrrolidine-3,4-diol |
| SMILES | COCCNCc1c(N2CC(O)C(O)C2)nc2sccn12 |
| InChI | InChI=1S/C13H20N4O3S/c1-20-4-2-14-6-9-12(15-13-17(9)3-5-21-13)16-7-10(18)11(19)8-16/h3,5,10-11,14,18-19H,2,4,6-8H2,1H3 |
| InChIKey | KEBNDABFGOBEMJ-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|