C12H16BrN3OS — CID 107084069
5-(bromomethyl)-6-[3-(methoxymethyl)pyrrolidin-1-yl]imidazo[2,1-b][1,3]thiazole (PubChem CID 107084069) has the molecular formula C12H16BrN3OS and a molecular weight of 330.25 g/mol. Its IUPAC name is 5-(bromomethyl)-6-[3-(methoxymethyl)pyrrolidin-1-yl]imidazo[2,1-b][1,3]thiazole.
| Compound Name | 5-(bromomethyl)-6-[3-(methoxymethyl)pyrrolidin-1-yl]imidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 107084069 |
| Molecular Formula | C12H16BrN3OS |
| Molecular Weight | 330.25 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | 5-(bromomethyl)-6-[3-(methoxymethyl)pyrrolidin-1-yl]imidazo[2,1-b][1,3]thiazole |
| SMILES | COCC1CCN(c2nc3sccn3c2CBr)C1 |
| InChI | InChI=1S/C12H16BrN3OS/c1-17-8-9-2-3-15(7-9)11-10(6-13)16-4-5-18-12(16)14-11/h4-5,9H,2-3,6-8H2,1H3 |
| InChIKey | OEZIAMIRDKFYTF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 29.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.25 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|