C12H16ClN3OS — CID 62972339
4-[5-(chloromethyl)imidazo[2,1-b][1,3]thiazol-6-yl]-2-methyl-1,4-oxazepane (PubChem CID 62972339) has the molecular formula C12H16ClN3OS and a molecular weight of 285.80 g/mol. Its IUPAC name is 4-[5-(chloromethyl)imidazo[2,1-b][1,3]thiazol-6-yl]-2-methyl-1,4-oxazepane.
| Compound Name | 4-[5-(chloromethyl)imidazo[2,1-b][1,3]thiazol-6-yl]-2-methyl-1,4-oxazepane |
|---|---|
| PubChem CID | 62972339 |
| Molecular Formula | C12H16ClN3OS |
| Molecular Weight | 285.80 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 4-[5-(chloromethyl)imidazo[2,1-b][1,3]thiazol-6-yl]-2-methyl-1,4-oxazepane |
| SMILES | CC1CN(c2nc3sccn3c2CCl)CCCO1 |
| InChI | InChI=1S/C12H16ClN3OS/c1-9-8-15(3-2-5-17-9)11-10(7-13)16-4-6-18-12(16)14-11/h4,6,9H,2-3,5,7-8H2,1H3 |
| InChIKey | KXOAYIIMNAOUAZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 29.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.80 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|