C10H15ClN2O2S — CID 103536912
4-(chloromethyl)-2-(3,4-dimethoxypyrrolidin-1-yl)-1,3-thiazole (PubChem CID 103536912) has the molecular formula C10H15ClN2O2S and a molecular weight of 262.76 g/mol. Its IUPAC name is 4-(chloromethyl)-2-(3,4-dimethoxypyrrolidin-1-yl)-1,3-thiazole.
| Compound Name | 4-(chloromethyl)-2-(3,4-dimethoxypyrrolidin-1-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 103536912 |
| Molecular Formula | C10H15ClN2O2S |
| Molecular Weight | 262.76 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 4-(chloromethyl)-2-(3,4-dimethoxypyrrolidin-1-yl)-1,3-thiazole |
| SMILES | COC1CN(c2nc(CCl)cs2)CC1OC |
| InChI | InChI=1S/C10H15ClN2O2S/c1-14-8-4-13(5-9(8)15-2)10-12-7(3-11)6-16-10/h6,8-9H,3-5H2,1-2H3 |
| InChIKey | STRYPWVVBDTKSZ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.76 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|