C11H18ClN3S — CID 63635882
4-(chloromethyl)-2-(4-ethyl-3-methylpiperazin-1-yl)-1,3-thiazole (PubChem CID 63635882) has the molecular formula C11H18ClN3S and a molecular weight of 259.81 g/mol. Its IUPAC name is 4-(chloromethyl)-2-(4-ethyl-3-methylpiperazin-1-yl)-1,3-thiazole.
| Compound Name | 4-(chloromethyl)-2-(4-ethyl-3-methylpiperazin-1-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 63635882 |
| Molecular Formula | C11H18ClN3S |
| Molecular Weight | 259.81 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 4-(chloromethyl)-2-(4-ethyl-3-methylpiperazin-1-yl)-1,3-thiazole |
| SMILES | CCN1CCN(c2nc(CCl)cs2)CC1C |
| InChI | InChI=1S/C11H18ClN3S/c1-3-14-4-5-15(7-9(14)2)11-13-10(6-12)8-16-11/h8-9H,3-7H2,1-2H3 |
| InChIKey | ZDDNZNMGEWMYEK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.81 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|