methyl 5-(1,3-dihydroisoindol-2-yl)pyrazine-2-carboxylate

C14H13N3O2 — CID 114059785

IUPACmethyl 5-(1,3-dihydroisoindol-2-yl)pyrazine-2-carboxylate
SMILESCOC(=O)c1cnc(N2Cc3ccccc3C2)cn1
InChIInChI=1S/C14H13N3O2/c1-19-14(18)12-6-16-13(7-15-12)17-8-10-4-2-3-5-11(10)9-17/h2-7H,8-9H2,1H3
InChIKeyNWOOWGBCHIRTKE-UHFFFAOYSA-N
MW255.28 g/mol
LogP1.78
Rot. Bonds2

About methyl 5-(1,3-dihydroisoindol-2-yl)pyrazine-2-carboxylate

methyl 5-(1,3-dihydroisoindol-2-yl)pyrazine-2-carboxylate (PubChem CID 114059785) has the molecular formula C14H13N3O2 and a molecular weight of 255.28 g/mol. Its IUPAC name is methyl 5-(1,3-dihydroisoindol-2-yl)pyrazine-2-carboxylate.

Molecular Properties

Compound Namemethyl 5-(1,3-dihydroisoindol-2-yl)pyrazine-2-carboxylate
PubChem CID114059785
Molecular FormulaC14H13N3O2
Molecular Weight255.28 g/mol
Exact Mass255.10
IUPAC Namemethyl 5-(1,3-dihydroisoindol-2-yl)pyrazine-2-carboxylate
SMILESCOC(=O)c1cnc(N2Cc3ccccc3C2)cn1
InChIInChI=1S/C14H13N3O2/c1-19-14(18)12-6-16-13(7-15-12)17-8-10-4-2-3-5-11(10)9-17/h2-7H,8-9H2,1H3
InChIKeyNWOOWGBCHIRTKE-UHFFFAOYSA-N
XLogP1.78
TPSA55.32 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.28
LogP ≤ 51.78
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 5-(1,3-dihydroisoindol-2-yl)pyrazine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-(1,3-dihydroisoindol-2-yl)pyrazine-2-carboxylate?
The IUPAC name of methyl 5-(1,3-dihydroisoindol-2-yl)pyrazine-2-carboxylate (CID 114059785) is methyl 5-(1,3-dihydroisoindol-2-yl)pyrazine-2-carboxylate.
What is the SMILES notation for methyl 5-(1,3-dihydroisoindol-2-yl)pyrazine-2-carboxylate?
The canonical SMILES for methyl 5-(1,3-dihydroisoindol-2-yl)pyrazine-2-carboxylate is COC(=O)c1cnc(N2Cc3ccccc3C2)cn1.
What is the InChIKey of methyl 5-(1,3-dihydroisoindol-2-yl)pyrazine-2-carboxylate?
The InChIKey is NWOOWGBCHIRTKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O2/c1-19-14(18)12-6-16-13(7-15-12)17-8-10-4-2-3-5-11(10)9-17/h2-7H,8-9H2,1H3.
What are the key properties of methyl 5-(1,3-dihydroisoindol-2-yl)pyrazine-2-carboxylate?
methyl 5-(1,3-dihydroisoindol-2-yl)pyrazine-2-carboxylate has a molecular weight of 255.28 g/mol, XLogP of 1.78, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(1,3-dihydroisoindol-2-yl)pyrazine-2-carboxylate is sourced from PubChem (CID 114059785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).