C11H14N4O5S — CID 168681086
methyl 5-[2-oxo-4-(sulfamoylmethyl)pyrrolidin-1-yl]pyrazine-2-carboxylate (PubChem CID 168681086) has the molecular formula C11H14N4O5S and a molecular weight of 314.32 g/mol. Its IUPAC name is methyl 5-[2-oxo-4-(sulfamoylmethyl)pyrrolidin-1-yl]pyrazine-2-carboxylate.
| Compound Name | methyl 5-[2-oxo-4-(sulfamoylmethyl)pyrrolidin-1-yl]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 168681086 |
| Molecular Formula | C11H14N4O5S |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | methyl 5-[2-oxo-4-(sulfamoylmethyl)pyrrolidin-1-yl]pyrazine-2-carboxylate |
| SMILES | COC(=O)c1cnc(N2CC(CS(N)(=O)=O)CC2=O)cn1 |
| InChI | InChI=1S/C11H14N4O5S/c1-20-11(17)8-3-14-9(4-13-8)15-5-7(2-10(15)16)6-21(12,18)19/h3-4,7H,2,5-6H2,1H3,(H2,12,18,19) |
| InChIKey | RUWJFMHSZGNRAF-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 132.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |