C12H16N4O5S — CID 168680845
ethyl 2-[2-oxo-4-(sulfamoylmethyl)pyrrolidin-1-yl]pyrimidine-5-carboxylate (PubChem CID 168680845) has the molecular formula C12H16N4O5S and a molecular weight of 328.35 g/mol. Its IUPAC name is ethyl 2-[2-oxo-4-(sulfamoylmethyl)pyrrolidin-1-yl]pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-[2-oxo-4-(sulfamoylmethyl)pyrrolidin-1-yl]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 168680845 |
| Molecular Formula | C12H16N4O5S |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | ethyl 2-[2-oxo-4-(sulfamoylmethyl)pyrrolidin-1-yl]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(N2CC(CS(N)(=O)=O)CC2=O)nc1 |
| InChI | InChI=1S/C12H16N4O5S/c1-2-21-11(18)9-4-14-12(15-5-9)16-6-8(3-10(16)17)7-22(13,19)20/h4-5,8H,2-3,6-7H2,1H3,(H2,13,19,20) |
| InChIKey | GMAHVPPOFPIUOK-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 132.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |