C14H16ClNO5S — CID 168672815
ethyl 4-[4-(chlorosulfonylmethyl)-2-oxopyrrolidin-1-yl]benzoate (PubChem CID 168672815) has the molecular formula C14H16ClNO5S and a molecular weight of 345.80 g/mol. Its IUPAC name is ethyl 4-[4-(chlorosulfonylmethyl)-2-oxopyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[4-(chlorosulfonylmethyl)-2-oxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 168672815 |
| Molecular Formula | C14H16ClNO5S |
| Molecular Weight | 345.80 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | ethyl 4-[4-(chlorosulfonylmethyl)-2-oxopyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2CC(CS(=O)(=O)Cl)CC2=O)cc1 |
| InChI | InChI=1S/C14H16ClNO5S/c1-2-21-14(18)11-3-5-12(6-4-11)16-8-10(7-13(16)17)9-22(15,19)20/h3-6,10H,2,7-9H2,1H3 |
| InChIKey | GIKKRRBPGNSXMR-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.80 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |