C14H18ClNO5S2 — CID 168672878
ethyl 2-[4-(chlorosulfonylmethyl)-2-oxopyrrolidin-1-yl]-5-ethylthiophene-3-carboxylate (PubChem CID 168672878) has the molecular formula C14H18ClNO5S2 and a molecular weight of 379.89 g/mol. Its IUPAC name is ethyl 2-[4-(chlorosulfonylmethyl)-2-oxopyrrolidin-1-yl]-5-ethylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[4-(chlorosulfonylmethyl)-2-oxopyrrolidin-1-yl]-5-ethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 168672878 |
| Molecular Formula | C14H18ClNO5S2 |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.03 |
| IUPAC Name | ethyl 2-[4-(chlorosulfonylmethyl)-2-oxopyrrolidin-1-yl]-5-ethylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(CC)sc1N1CC(CS(=O)(=O)Cl)CC1=O |
| InChI | InChI=1S/C14H18ClNO5S2/c1-3-10-6-11(14(18)21-4-2)13(22-10)16-7-9(5-12(16)17)8-23(15,19)20/h6,9H,3-5,7-8H2,1-2H3 |
| InChIKey | GJMHWWBTWRHVKH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |