C12H15NO4S — CID 168702068
methyl 5-ethyl-2-(4-hydroxy-2-oxopyrrolidin-1-yl)thiophene-3-carboxylate (PubChem CID 168702068) has the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. Its IUPAC name is methyl 5-ethyl-2-(4-hydroxy-2-oxopyrrolidin-1-yl)thiophene-3-carboxylate.
| Compound Name | methyl 5-ethyl-2-(4-hydroxy-2-oxopyrrolidin-1-yl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 168702068 |
| Molecular Formula | C12H15NO4S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | methyl 5-ethyl-2-(4-hydroxy-2-oxopyrrolidin-1-yl)thiophene-3-carboxylate |
| SMILES | CCc1cc(C(=O)OC)c(N2CC(O)CC2=O)s1 |
| InChI | InChI=1S/C12H15NO4S/c1-3-8-5-9(12(16)17-2)11(18-8)13-6-7(14)4-10(13)15/h5,7,14H,3-4,6H2,1-2H3 |
| InChIKey | LSFNWCCKKVSTFC-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |