C11H12N2O4 — CID 168702204
methyl 4-(4-hydroxy-2-oxopyrrolidin-1-yl)pyridine-3-carboxylate (PubChem CID 168702204) has the molecular formula C11H12N2O4 and a molecular weight of 236.23 g/mol. Its IUPAC name is methyl 4-(4-hydroxy-2-oxopyrrolidin-1-yl)pyridine-3-carboxylate.
| Compound Name | methyl 4-(4-hydroxy-2-oxopyrrolidin-1-yl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 168702204 |
| Molecular Formula | C11H12N2O4 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | methyl 4-(4-hydroxy-2-oxopyrrolidin-1-yl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1cnccc1N1CC(O)CC1=O |
| InChI | InChI=1S/C11H12N2O4/c1-17-11(16)8-5-12-3-2-9(8)13-6-7(14)4-10(13)15/h2-3,5,7,14H,4,6H2,1H3 |
| InChIKey | HHVPRUXSNGJSBF-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |