C12H13BrN2O3 — CID 168504056
methyl 4-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]pyridine-3-carboxylate (PubChem CID 168504056) has the molecular formula C12H13BrN2O3 and a molecular weight of 313.15 g/mol. Its IUPAC name is methyl 4-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]pyridine-3-carboxylate.
| Compound Name | methyl 4-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 168504056 |
| Molecular Formula | C12H13BrN2O3 |
| Molecular Weight | 313.15 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | methyl 4-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cnccc1N1CC(CBr)CC1=O |
| InChI | InChI=1S/C12H13BrN2O3/c1-18-12(17)9-6-14-3-2-10(9)15-7-8(5-13)4-11(15)16/h2-3,6,8H,4-5,7H2,1H3 |
| InChIKey | QKYMUQCEKGHVKP-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.15 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|