C13H12BrF2NO3 — CID 168504006
methyl 2-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]-4,5-difluorobenzoate (PubChem CID 168504006) has the molecular formula C13H12BrF2NO3 and a molecular weight of 348.14 g/mol. Its IUPAC name is methyl 2-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]-4,5-difluorobenzoate.
| Compound Name | methyl 2-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 168504006 |
| Molecular Formula | C13H12BrF2NO3 |
| Molecular Weight | 348.14 g/mol |
| Exact Mass | 347.00 |
| IUPAC Name | methyl 2-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]-4,5-difluorobenzoate |
| SMILES | COC(=O)c1cc(F)c(F)cc1N1CC(CBr)CC1=O |
| InChI | InChI=1S/C13H12BrF2NO3/c1-20-13(19)8-3-9(15)10(16)4-11(8)17-6-7(5-14)2-12(17)18/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | NZVYPGAQTIMMAQ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.14 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|