C12H13NO5 — CID 168702194
methyl 2-hydroxy-4-(4-hydroxy-2-oxopyrrolidin-1-yl)benzoate (PubChem CID 168702194) has the molecular formula C12H13NO5 and a molecular weight of 251.24 g/mol. Its IUPAC name is methyl 2-hydroxy-4-(4-hydroxy-2-oxopyrrolidin-1-yl)benzoate.
| Compound Name | methyl 2-hydroxy-4-(4-hydroxy-2-oxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 168702194 |
| Molecular Formula | C12H13NO5 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | methyl 2-hydroxy-4-(4-hydroxy-2-oxopyrrolidin-1-yl)benzoate |
| SMILES | COC(=O)c1ccc(N2CC(O)CC2=O)cc1O |
| InChI | InChI=1S/C12H13NO5/c1-18-12(17)9-3-2-7(4-10(9)15)13-6-8(14)5-11(13)16/h2-4,8,14-15H,5-6H2,1H3 |
| InChIKey | DNEDTAMGZUETGI-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |