C12H13FN2O5S — CID 168717283
methyl 2-fluoro-4-(2-oxo-4-sulfamoylpyrrolidin-1-yl)benzoate (PubChem CID 168717283) has the molecular formula C12H13FN2O5S and a molecular weight of 316.31 g/mol. Its IUPAC name is methyl 2-fluoro-4-(2-oxo-4-sulfamoylpyrrolidin-1-yl)benzoate.
| Compound Name | methyl 2-fluoro-4-(2-oxo-4-sulfamoylpyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 168717283 |
| Molecular Formula | C12H13FN2O5S |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | methyl 2-fluoro-4-(2-oxo-4-sulfamoylpyrrolidin-1-yl)benzoate |
| SMILES | COC(=O)c1ccc(N2CC(S(N)(=O)=O)CC2=O)cc1F |
| InChI | InChI=1S/C12H13FN2O5S/c1-20-12(17)9-3-2-7(4-10(9)13)15-6-8(5-11(15)16)21(14,18)19/h2-4,8H,5-6H2,1H3,(H2,14,18,19) |
| InChIKey | ZUZAOACNUIFCFV-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |