C13H18N2O3S — CID 168659364
methyl 2-[4-(aminomethyl)-2-oxopyrrolidin-1-yl]-5-ethylthiophene-3-carboxylate (PubChem CID 168659364) has the molecular formula C13H18N2O3S and a molecular weight of 282.36 g/mol. Its IUPAC name is methyl 2-[4-(aminomethyl)-2-oxopyrrolidin-1-yl]-5-ethylthiophene-3-carboxylate.
| Compound Name | methyl 2-[4-(aminomethyl)-2-oxopyrrolidin-1-yl]-5-ethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 168659364 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | methyl 2-[4-(aminomethyl)-2-oxopyrrolidin-1-yl]-5-ethylthiophene-3-carboxylate |
| SMILES | CCc1cc(C(=O)OC)c(N2CC(CN)CC2=O)s1 |
| InChI | InChI=1S/C13H18N2O3S/c1-3-9-5-10(13(17)18-2)12(19-9)15-7-8(6-14)4-11(15)16/h5,8H,3-4,6-7,14H2,1-2H3 |
| InChIKey | QDGOANRBIHDUCR-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |