C13H13NO4S — CID 954109
ethyl 2-(2,5-dioxopyrrol-1-yl)-5-ethylthiophene-3-carboxylate (PubChem CID 954109) has the molecular formula C13H13NO4S and a molecular weight of 279.32 g/mol. Its IUPAC name is ethyl 2-(2,5-dioxopyrrol-1-yl)-5-ethylthiophene-3-carboxylate.
| Compound Name | ethyl 2-(2,5-dioxopyrrol-1-yl)-5-ethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 954109 |
| Molecular Formula | C13H13NO4S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | ethyl 2-(2,5-dioxopyrrol-1-yl)-5-ethylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(CC)sc1N1C(=O)C=CC1=O |
| InChI | InChI=1S/C13H13NO4S/c1-3-8-7-9(13(17)18-4-2)12(19-8)14-10(15)5-6-11(14)16/h5-7H,3-4H2,1-2H3 |
| InChIKey | GNJPUXNRVSPJEW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|