C14H16Cl2N2O4S — CID 168672902
[1-[5-chloro-2-(dimethylcarbamoyl)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonyl chloride (PubChem CID 168672902) has the molecular formula C14H16Cl2N2O4S and a molecular weight of 379.27 g/mol. Its IUPAC name is [1-[5-chloro-2-(dimethylcarbamoyl)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonyl chloride.
| Compound Name | [1-[5-chloro-2-(dimethylcarbamoyl)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
|---|---|
| PubChem CID | 168672902 |
| Molecular Formula | C14H16Cl2N2O4S |
| Molecular Weight | 379.27 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | [1-[5-chloro-2-(dimethylcarbamoyl)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
| SMILES | CN(C)C(=O)c1ccc(Cl)cc1N1CC(CS(=O)(=O)Cl)CC1=O |
| InChI | InChI=1S/C14H16Cl2N2O4S/c1-17(2)14(20)11-4-3-10(15)6-12(11)18-7-9(5-13(18)19)8-23(16,21)22/h3-4,6,9H,5,7-8H2,1-2H3 |
| InChIKey | MLTZYNYJAHYDRO-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |