C10H14BN3O5S — CID 168683338
[6-[2-oxo-4-(sulfamoylmethyl)pyrrolidin-1-yl]-3-pyridinyl]boronic acid (PubChem CID 168683338) has the molecular formula C10H14BN3O5S and a molecular weight of 299.12 g/mol. Its IUPAC name is [6-[2-oxo-4-(sulfamoylmethyl)pyrrolidin-1-yl]-3-pyridinyl]boronic acid.
| Compound Name | [6-[2-oxo-4-(sulfamoylmethyl)pyrrolidin-1-yl]-3-pyridinyl]boronic acid |
|---|---|
| PubChem CID | 168683338 |
| Molecular Formula | C10H14BN3O5S |
| Molecular Weight | 299.12 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | [6-[2-oxo-4-(sulfamoylmethyl)pyrrolidin-1-yl]-3-pyridinyl]boronic acid |
| SMILES | NS(=O)(=O)CC1CC(=O)N(c2ccc(B(O)O)cn2)C1 |
| InChI | InChI=1S/C10H14BN3O5S/c12-20(18,19)6-7-3-10(15)14(5-7)9-2-1-8(4-13-9)11(16)17/h1-2,4,7,16-17H,3,5-6H2,(H2,12,18,19) |
| InChIKey | DDWFRGUECOOQRD-UHFFFAOYSA-N |
| XLogP | -2.60 |
| TPSA | 133.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.12 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|