C10H12BN3O4 — CID 168698570
[6-(4-carbamoyl-2-oxopyrrolidin-1-yl)-3-pyridinyl]boronic acid (PubChem CID 168698570) has the molecular formula C10H12BN3O4 and a molecular weight of 249.03 g/mol. Its IUPAC name is [6-(4-carbamoyl-2-oxopyrrolidin-1-yl)-3-pyridinyl]boronic acid.
| Compound Name | [6-(4-carbamoyl-2-oxopyrrolidin-1-yl)-3-pyridinyl]boronic acid |
|---|---|
| PubChem CID | 168698570 |
| Molecular Formula | C10H12BN3O4 |
| Molecular Weight | 249.03 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | [6-(4-carbamoyl-2-oxopyrrolidin-1-yl)-3-pyridinyl]boronic acid |
| SMILES | NC(=O)C1CC(=O)N(c2ccc(B(O)O)cn2)C1 |
| InChI | InChI=1S/C10H12BN3O4/c12-10(16)6-3-9(15)14(5-6)8-2-1-7(4-13-8)11(17)18/h1-2,4,6,17-18H,3,5H2,(H2,12,16) |
| InChIKey | DSAJEWLNJZLZAG-UHFFFAOYSA-N |
| XLogP | -2.40 |
| TPSA | 116.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.03 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|